Alcian blue
| Alcian blue |
|
Other names
Alcian blue 8GX, Ingrain blue 1, C.I. 74240
|
| Identifiers |
| CAS number |
33864-99-2 Y |
| PubChem |
3084579 |
| ChemSpider |
2341620 Y |
| Jmol-3D images |
Image 1
Image 2 |
-
CN(C)C(=[N+](C)C)SCC1=CC2=C(C=C1)C3=NC4=NC(=NC5=C6C=C (C=CC6=C([N-]5)N=C7C8=C(C=CC(=C8)CSC(=[N+](C)C)N(C)C)C(=N7) N=C2[N-]3)CSC(=[N+](C)C)N(C)C)C9=C4C=CC(=C9)CSC(=[N+](C)C)N(C)C. [Cl-]. [Cl-].[Cl-].[Cl-].[Cu+2]
[Cu+2].[Cl-].[Cl-].[Cl-].[Cl-].S(/C(=[N+](/C)C)N(C)C)Cc8ccc9c1[n-]c(nc7nc(nc4[n-]c(nc2nc(n1)c3ccc(cc23)CS/C(=[N+](/C)C)N(C)C)c5c4ccc(c5)CS/C(=[N+](/C)C)N(C)C)c6cc(ccc67)CS/C(=[N+](/C)C)N(C)C)c9c8
|
-
InChI=1S/C56H68N16S4.4ClH.Cu/c1-65(2)53(66(3)4)73-29-33-17-21-37-41(25-33)49-58-45(37)57-46-38-22-18-35(31-75-55(69(9)10)70(11)12)27-43(38)51(59-46)64-52-44-28-36(32-76-56(71(13)14)72(15)16)20-24-40(44)48(63-52)62-50-42-26-34(19-23-39(42)47(60-49)61-50)30-74-54(67(5)6)68(7)8;;;;;/h17-28H,29-32H2,1-16H3;4*1H;/q+2;;;;;+2/p-4 Y
Key: KDXHLJMVLXJXCW-UHFFFAOYSA-J Y
InChI=1/C56H68N16S4.4ClH.Cu/c1-65(2)53(66(3)4)73-29-33- 17-21-37-41(25-33)49-58-45(37)57-46-38-22-18-35(31-75-55 (69(9)10)70(11)12)27-43(38)51(59-46)64-52-44-28-36(32-76- -56(71(13)14)72(15)16)20-24-40(44)48(63-52)62-50-42-26- 34(19-23-39(42)47(60-49)61-50)30-74-54(67(5)6)68(7)8;;;;;/h17- -28H,29-32H2,1-16H3;4*1H;/q+2;;;;;+2/p-4/fC56H68N16S4.4 Cl.Cu/h;4*1h;/qm;4*-1;m
InChI=1/C56H68N16S4.4ClH.Cu/c1-65(2)53(66(3)4)73-29-33-17-21-37-41(25-33)49-58-45(37)57-46-38-22-18-35(31-75-55(69(9)10)70(11)12)27-43(38)51(59-46)64-52-44-28-36(32-76-56(71(13)14)72(15)16)20-24-40(44)48(63-52)62-50-42-26-34(19-23-39(42)47(60-49)61-50)30-74-54(67(5)6)68(7)8;;;;;/h17-28H,29-32H2,1-16H3;4*1H;/q+2;;;;;+2/p-4
Key: KDXHLJMVLXJXCW-XBHQNQODAQ
|
| Properties |
| Molecular formula |
C56H68Cl4CuN16S4 |
| Molar mass |
1298.86 g mol−1 |
Y (verify) (what is: Y/N?)
Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) |
| Infobox references |
Alcian blue (AB), also called Alcian blue 8GX, Ingrain blue 1, and C.I. 74240, is a copper phthalocyanine, first synthesized by the ICI dyestuffs department under N. H. Haddock in 1947, originally as a textile dye. The dye stains acid mucopolysaccharides and glycosaminoglycans, for which it is one of the most widely used cationic dyes; the stained parts are blue to bluish-green. It can be combined with H&E staining and van Gieson staining methods. It bonds by electrostatic forces with the negatively charged macromolecules. Gradual increases in the electrolyte concentration used to wash the bound dye selectively identifies neutral, sulphated, and phosphated mucopolysaccharides.
External links